C14H24N2O4 — CID 59532919
propan-2-yl 4-oxo-4-[4-(prop-2-enoylamino)butylamino]butanoate (PubChem CID 59532919) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is propan-2-yl 4-oxo-4-[4-(prop-2-enoylamino)butylamino]butanoate.
| Compound Name | propan-2-yl 4-oxo-4-[4-(prop-2-enoylamino)butylamino]butanoate |
|---|---|
| PubChem CID | 59532919 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | propan-2-yl 4-oxo-4-[4-(prop-2-enoylamino)butylamino]butanoate |
| SMILES | C=CC(=O)NCCCCNC(=O)CCC(=O)OC(C)C |
| InChI | InChI=1S/C14H24N2O4/c1-4-12(17)15-9-5-6-10-16-13(18)7-8-14(19)20-11(2)3/h4,11H,1,5-10H2,2-3H3,(H,15,17)(H,16,18) |
| InChIKey | DXFDKZGZUCSEIA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|