C35H47FN6O3 — CID 59534339
tert-butyl N-benzyl-N-[5-[[(2R)-9-(6-fluoro-3-pyridinyl)-1-hydroxynonan-2-yl]amino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl]carbamate (PubChem CID 59534339) has the molecular formula C35H47FN6O3 and a molecular weight of 618.80 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[5-[[(2R)-9-(6-fluoro-3-pyridinyl)-1-hydroxynonan-2-yl]amino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[5-[[(2R)-9-(6-fluoro-3-pyridinyl)-1-hydroxynonan-2-yl]amino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl]carbamate |
|---|---|
| PubChem CID | 59534339 |
| Molecular Formula | C35H47FN6O3 |
| Molecular Weight | 618.80 g/mol |
| Exact Mass | 618.37 |
| IUPAC Name | tert-butyl N-benzyl-N-[5-[[(2R)-9-(6-fluoro-3-pyridinyl)-1-hydroxynonan-2-yl]amino]-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl]carbamate |
| SMILES | CC(C)c1cnn2c(N(Cc3ccccc3)C(=O)OC(C)(C)C)cc(N[C@@H](CO)CCCCCCCc3ccc(F)nc3)nc12 |
| InChI | InChI=1S/C35H47FN6O3/c1-25(2)29-22-38-42-32(41(34(44)45-35(3,4)5)23-27-15-11-9-12-16-27)20-31(40-33(29)42)39-28(24-43)17-13-8-6-7-10-14-26-18-19-30(36)37-21-26/h9,11-12,15-16,18-22,25,28,43H,6-8,10,13-14,17,23-24H2,1-5H3,(H,39,40)/t28-/m1/s1 |
| InChIKey | LDIFTBYISFTGFU-MUUNZHRXSA-N |
| XLogP | 7.68 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.80 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|