C16H23BO3 — CID 59535348
[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropyl]methanol (PubChem CID 59535348) has the molecular formula C16H23BO3 and a molecular weight of 274.17 g/mol. Its IUPAC name is [1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropyl]methanol.
| Compound Name | [1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 59535348 |
| Molecular Formula | C16H23BO3 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | [1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropyl]methanol |
| SMILES | CC1(C)OB(c2ccc(C3(CO)CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C16H23BO3/c1-14(2)15(3,4)20-17(19-14)13-7-5-12(6-8-13)16(11-18)9-10-16/h5-8,18H,9-11H2,1-4H3 |
| InChIKey | WLKBNPVGNWGUSP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|