C12H18N2O2 — CID 59542614
1,2-oxazol-5-yl-(4-propan-2-ylpiperidin-1-yl)methanone (PubChem CID 59542614) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 1,2-oxazol-5-yl-(4-propan-2-ylpiperidin-1-yl)methanone.
| Compound Name | 1,2-oxazol-5-yl-(4-propan-2-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 59542614 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1,2-oxazol-5-yl-(4-propan-2-ylpiperidin-1-yl)methanone |
| SMILES | CC(C)C1CCN(C(=O)c2ccno2)CC1 |
| InChI | InChI=1S/C12H18N2O2/c1-9(2)10-4-7-14(8-5-10)12(15)11-3-6-13-16-11/h3,6,9-10H,4-5,7-8H2,1-2H3 |
| InChIKey | KOUMLVWEHDPIEK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |