C26H27N3O4 — CID 59544692
(1-pyridin-3-ylcyclopentyl) N-[(1S)-1-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]ethyl]carbamate (PubChem CID 59544692) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is (1-pyridin-3-ylcyclopentyl) N-[(1S)-1-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]ethyl]carbamate.
| Compound Name | (1-pyridin-3-ylcyclopentyl) N-[(1S)-1-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 59544692 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (1-pyridin-3-ylcyclopentyl) N-[(1S)-1-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC1(c2cccnc2)CCCC1)c1ccc(C(=O)Nc2ccccc2O)cc1 |
| InChI | InChI=1S/C26H27N3O4/c1-18(28-25(32)33-26(14-4-5-15-26)21-7-6-16-27-17-21)19-10-12-20(13-11-19)24(31)29-22-8-2-3-9-23(22)30/h2-3,6-13,16-18,30H,4-5,14-15H2,1H3,(H,28,32)(H,29,31)/t18-/m0/s1 |
| InChIKey | VIPOEAKIFUTYLB-SFHVURJKSA-N |
| XLogP | 5.30 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|