C27H22ClN3O4 — CID 59544615
[(S)-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]-phenylmethyl] N-[(4-chloro-3-pyridinyl)methyl]carbamate (PubChem CID 59544615) has the molecular formula C27H22ClN3O4 and a molecular weight of 487.94 g/mol. Its IUPAC name is [(S)-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]-phenylmethyl] N-[(4-chloro-3-pyridinyl)methyl]carbamate.
| Compound Name | [(S)-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]-phenylmethyl] N-[(4-chloro-3-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 59544615 |
| Molecular Formula | C27H22ClN3O4 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | [(S)-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]-phenylmethyl] N-[(4-chloro-3-pyridinyl)methyl]carbamate |
| SMILES | O=C(NCc1cnccc1Cl)O[C@@H](c1ccccc1)c1ccc(C(=O)Nc2ccccc2O)cc1 |
| InChI | InChI=1S/C27H22ClN3O4/c28-22-14-15-29-16-21(22)17-30-27(34)35-25(18-6-2-1-3-7-18)19-10-12-20(13-11-19)26(33)31-23-8-4-5-9-24(23)32/h1-16,25,32H,17H2,(H,30,34)(H,31,33)/t25-/m0/s1 |
| InChIKey | VHLCCEZBBUHQKI-VWLOTQADSA-N |
| XLogP | 5.71 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|