C29H26ClN3O4 — CID 59544703
[(S)-(5-chloro-3-pyridinyl)-phenylmethyl] N-[(1S)-1-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]propyl]carbamate (PubChem CID 59544703) has the molecular formula C29H26ClN3O4 and a molecular weight of 516.00 g/mol. Its IUPAC name is [(S)-(5-chloro-3-pyridinyl)-phenylmethyl] N-[(1S)-1-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]propyl]carbamate.
| Compound Name | [(S)-(5-chloro-3-pyridinyl)-phenylmethyl] N-[(1S)-1-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 59544703 |
| Molecular Formula | C29H26ClN3O4 |
| Molecular Weight | 516.00 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | [(S)-(5-chloro-3-pyridinyl)-phenylmethyl] N-[(1S)-1-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]propyl]carbamate |
| SMILES | CC[C@H](NC(=O)O[C@@H](c1ccccc1)c1cncc(Cl)c1)c1ccc(C(=O)Nc2ccccc2O)cc1 |
| InChI | InChI=1S/C29H26ClN3O4/c1-2-24(19-12-14-21(15-13-19)28(35)32-25-10-6-7-11-26(25)34)33-29(36)37-27(20-8-4-3-5-9-20)22-16-23(30)18-31-17-22/h3-18,24,27,34H,2H2,1H3,(H,32,35)(H,33,36)/t24-,27-/m0/s1 |
| InChIKey | WDDOIQXKLFZUOH-IGKIAQTJSA-N |
| XLogP | 6.66 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.00 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|