C18H13F5N4O — CID 59547994
N-[1-[[5-amino-2-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]-2,6-difluorobenzamide (PubChem CID 59547994) has the molecular formula C18H13F5N4O and a molecular weight of 396.32 g/mol. Its IUPAC name is N-[1-[[5-amino-2-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]-2,6-difluorobenzamide.
| Compound Name | N-[1-[[5-amino-2-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 59547994 |
| Molecular Formula | C18H13F5N4O |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[1-[[5-amino-2-(trifluoromethyl)phenyl]methyl]pyrazol-3-yl]-2,6-difluorobenzamide |
| SMILES | Nc1ccc(C(F)(F)F)c(Cn2ccc(NC(=O)c3c(F)cccc3F)n2)c1 |
| InChI | InChI=1S/C18H13F5N4O/c19-13-2-1-3-14(20)16(13)17(28)25-15-6-7-27(26-15)9-10-8-11(24)4-5-12(10)18(21,22)23/h1-8H,9,24H2,(H,25,26,28) |
| InChIKey | FGXIZXNKLGOVJU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|