C21H16Cl2F3N3O — CID 91044700
2,6-dichloro-N-[1-[[2-(1,1-difluorobut-2-enyl)-6-fluorophenyl]methyl]pyrazol-3-yl]benzamide (PubChem CID 91044700) has the molecular formula C21H16Cl2F3N3O and a molecular weight of 454.28 g/mol. Its IUPAC name is 2,6-dichloro-N-[1-[[2-(1,1-difluorobut-2-enyl)-6-fluorophenyl]methyl]pyrazol-3-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[1-[[2-(1,1-difluorobut-2-enyl)-6-fluorophenyl]methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 91044700 |
| Molecular Formula | C21H16Cl2F3N3O |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 2,6-dichloro-N-[1-[[2-(1,1-difluorobut-2-enyl)-6-fluorophenyl]methyl]pyrazol-3-yl]benzamide |
| SMILES | CC=CC(F)(F)c1cccc(F)c1Cn1ccc(NC(=O)c2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C21H16Cl2F3N3O/c1-2-10-21(25,26)14-5-3-8-17(24)13(14)12-29-11-9-18(28-29)27-20(30)19-15(22)6-4-7-16(19)23/h2-11H,12H2,1H3,(H,27,28,30) |
| InChIKey | CHRVFEINTKAMHS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|