C19H15Cl2F3IN3O — CID 162588013
2,6-dichloro-N-[1-[[4-iodo-4-methyl-6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl]pyrazol-3-yl]benzamide (PubChem CID 162588013) has the molecular formula C19H15Cl2F3IN3O and a molecular weight of 556.15 g/mol. Its IUPAC name is 2,6-dichloro-N-[1-[[4-iodo-4-methyl-6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl]pyrazol-3-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[1-[[4-iodo-4-methyl-6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 162588013 |
| Molecular Formula | C19H15Cl2F3IN3O |
| Molecular Weight | 556.15 g/mol |
| Exact Mass | 554.96 |
| IUPAC Name | 2,6-dichloro-N-[1-[[4-iodo-4-methyl-6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl]pyrazol-3-yl]benzamide |
| SMILES | CC1(I)C=C(C(F)(F)F)C(Cn2ccc(NC(=O)c3c(Cl)cccc3Cl)n2)=CC1 |
| InChI | InChI=1S/C19H15Cl2F3IN3O/c1-18(25)7-5-11(12(9-18)19(22,23)24)10-28-8-6-15(27-28)26-17(29)16-13(20)3-2-4-14(16)21/h2-6,8-9H,7,10H2,1H3,(H,26,27,29) |
| InChIKey | BFSKRWQEYLSRIA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.15 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|