(2S)-2,3-bis(methylamino)propanoic acid

C5H12N2O2 — CID 59549254

IUPAC(2S)-2,3-bis(methylamino)propanoic acid
SMILESCNC[C@H](NC)C(=O)O
InChIInChI=1S/C5H12N2O2/c1-6-3-4(7-2)5(8)9/h4,6-7H,3H2,1-2H3,(H,8,9)/t4-/m0/s1
InChIKeyAWNBKWIVRUZDKR-BYPYZUCNSA-N
MW132.16 g/mol
LogP-1.12
Rot. Bonds4

About (2S)-2,3-bis(methylamino)propanoic acid

(2S)-2,3-bis(methylamino)propanoic acid (PubChem CID 59549254) has the molecular formula C5H12N2O2 and a molecular weight of 132.16 g/mol. Its IUPAC name is (2S)-2,3-bis(methylamino)propanoic acid.

Molecular Properties

Compound Name(2S)-2,3-bis(methylamino)propanoic acid
PubChem CID59549254
Molecular FormulaC5H12N2O2
Molecular Weight132.16 g/mol
Exact Mass132.09
IUPAC Name(2S)-2,3-bis(methylamino)propanoic acid
SMILESCNC[C@H](NC)C(=O)O
InChIInChI=1S/C5H12N2O2/c1-6-3-4(7-2)5(8)9/h4,6-7H,3H2,1-2H3,(H,8,9)/t4-/m0/s1
InChIKeyAWNBKWIVRUZDKR-BYPYZUCNSA-N
XLogP-1.12
TPSA61.36 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.16
LogP ≤ 5-1.12
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S)-2,3-bis(methylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2,3-bis(methylamino)propanoic acid?
The IUPAC name of (2S)-2,3-bis(methylamino)propanoic acid (CID 59549254) is (2S)-2,3-bis(methylamino)propanoic acid.
What is the SMILES notation for (2S)-2,3-bis(methylamino)propanoic acid?
The canonical SMILES for (2S)-2,3-bis(methylamino)propanoic acid is CNC[C@H](NC)C(=O)O.
What is the InChIKey of (2S)-2,3-bis(methylamino)propanoic acid?
The InChIKey is AWNBKWIVRUZDKR-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H12N2O2/c1-6-3-4(7-2)5(8)9/h4,6-7H,3H2,1-2H3,(H,8,9)/t4-/m0/s1.
What are the key properties of (2S)-2,3-bis(methylamino)propanoic acid?
(2S)-2,3-bis(methylamino)propanoic acid has a molecular weight of 132.16 g/mol, XLogP of -1.12, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-bis(methylamino)propanoic acid is sourced from PubChem (CID 59549254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).