C5H12N2O2 — CID 59549254
(2S)-2,3-bis(methylamino)propanoic acid (PubChem CID 59549254) has the molecular formula C5H12N2O2 and a molecular weight of 132.16 g/mol. Its IUPAC name is (2S)-2,3-bis(methylamino)propanoic acid.
| Compound Name | (2S)-2,3-bis(methylamino)propanoic acid |
|---|---|
| PubChem CID | 59549254 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (2S)-2,3-bis(methylamino)propanoic acid |
| SMILES | CNC[C@H](NC)C(=O)O |
| InChI | InChI=1S/C5H12N2O2/c1-6-3-4(7-2)5(8)9/h4,6-7H,3H2,1-2H3,(H,8,9)/t4-/m0/s1 |
| InChIKey | AWNBKWIVRUZDKR-BYPYZUCNSA-N |
| XLogP | -1.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |