C30H36N6O3 — CID 59555577
1-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-3-(1H-indol-3-yl)-2-[4-(pyridin-4-ylamino)anilino]propan-1-one (PubChem CID 59555577) has the molecular formula C30H36N6O3 and a molecular weight of 528.66 g/mol. Its IUPAC name is 1-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-3-(1H-indol-3-yl)-2-[4-(pyridin-4-ylamino)anilino]propan-1-one.
| Compound Name | 1-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-3-(1H-indol-3-yl)-2-[4-(pyridin-4-ylamino)anilino]propan-1-one |
|---|---|
| PubChem CID | 59555577 |
| Molecular Formula | C30H36N6O3 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | 1-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-3-(1H-indol-3-yl)-2-[4-(pyridin-4-ylamino)anilino]propan-1-one |
| SMILES | O=C(C(Cc1c[nH]c2ccccc12)Nc1ccc(Nc2ccncc2)cc1)N1CCN(CCOCCO)CC1 |
| InChI | InChI=1S/C30H36N6O3/c37-18-20-39-19-17-35-13-15-36(16-14-35)30(38)29(21-23-22-32-28-4-2-1-3-27(23)28)34-25-7-5-24(6-8-25)33-26-9-11-31-12-10-26/h1-12,22,29,32,34,37H,13-21H2,(H,31,33) |
| InChIKey | QCKVRBQMDCEYKW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|