C33H36N6O — CID 59555817
N-benzyl-N-[2-(dimethylamino)ethyl]-3-(1H-indol-3-yl)-2-[4-(pyridin-4-ylamino)anilino]propanamide (PubChem CID 59555817) has the molecular formula C33H36N6O and a molecular weight of 532.69 g/mol. Its IUPAC name is N-benzyl-N-[2-(dimethylamino)ethyl]-3-(1H-indol-3-yl)-2-[4-(pyridin-4-ylamino)anilino]propanamide.
| Compound Name | N-benzyl-N-[2-(dimethylamino)ethyl]-3-(1H-indol-3-yl)-2-[4-(pyridin-4-ylamino)anilino]propanamide |
|---|---|
| PubChem CID | 59555817 |
| Molecular Formula | C33H36N6O |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | N-benzyl-N-[2-(dimethylamino)ethyl]-3-(1H-indol-3-yl)-2-[4-(pyridin-4-ylamino)anilino]propanamide |
| SMILES | CN(C)CCN(Cc1ccccc1)C(=O)C(Cc1c[nH]c2ccccc12)Nc1ccc(Nc2ccncc2)cc1 |
| InChI | InChI=1S/C33H36N6O/c1-38(2)20-21-39(24-25-8-4-3-5-9-25)33(40)32(22-26-23-35-31-11-7-6-10-30(26)31)37-28-14-12-27(13-15-28)36-29-16-18-34-19-17-29/h3-19,23,32,35,37H,20-22,24H2,1-2H3,(H,34,36) |
| InChIKey | GNGOPPXEXLXIFJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|