C27H29N5O2 — CID 59555792
1-[3-(hydroxymethyl)pyrrolidin-1-yl]-3-(1H-indol-3-yl)-2-[4-(pyridin-4-ylamino)anilino]propan-1-one (PubChem CID 59555792) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 1-[3-(hydroxymethyl)pyrrolidin-1-yl]-3-(1H-indol-3-yl)-2-[4-(pyridin-4-ylamino)anilino]propan-1-one.
| Compound Name | 1-[3-(hydroxymethyl)pyrrolidin-1-yl]-3-(1H-indol-3-yl)-2-[4-(pyridin-4-ylamino)anilino]propan-1-one |
|---|---|
| PubChem CID | 59555792 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 1-[3-(hydroxymethyl)pyrrolidin-1-yl]-3-(1H-indol-3-yl)-2-[4-(pyridin-4-ylamino)anilino]propan-1-one |
| SMILES | O=C(C(Cc1c[nH]c2ccccc12)Nc1ccc(Nc2ccncc2)cc1)N1CCC(CO)C1 |
| InChI | InChI=1S/C27H29N5O2/c33-18-19-11-14-32(17-19)27(34)26(15-20-16-29-25-4-2-1-3-24(20)25)31-22-7-5-21(6-8-22)30-23-9-12-28-13-10-23/h1-10,12-13,16,19,26,29,31,33H,11,14-15,17-18H2,(H,28,30) |
| InChIKey | YULNKGUGAJTCRW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|