C23H25ClN4O3 — CID 59558446
CID 59558446 (PubChem CID 59558446) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol.
| Compound Name | CID 59558446 |
|---|---|
| PubChem CID | 59558446 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)c1[nH]c3c(c1C(=O)NC21CC1)CCc1cnc(Cl)cc1-3 |
| InChI | InChI=1S/C23H25ClN4O3/c1-21(2,3)31-20(30)28-10-22(11-28)18-16(19(29)27-23(22)6-7-23)13-5-4-12-9-25-15(24)8-14(12)17(13)26-18/h8-9,26H,4-7,10-11H2,1-3H3,(H,27,29) |
| InChIKey | DFWKWOWEAHUUTL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|