C45H44N2O6 — CID 59559085
oxan-2-yl 3-[4-[4-[3-(oxan-2-yloxy)-3-oxopropyl]-N-(pyren-4-ylmethylideneamino)anilino]phenyl]propanoate (PubChem CID 59559085) has the molecular formula C45H44N2O6 and a molecular weight of 708.86 g/mol. Its IUPAC name is oxan-2-yl 3-[4-[4-[3-(oxan-2-yloxy)-3-oxopropyl]-N-(pyren-4-ylmethylideneamino)anilino]phenyl]propanoate.
| Compound Name | oxan-2-yl 3-[4-[4-[3-(oxan-2-yloxy)-3-oxopropyl]-N-(pyren-4-ylmethylideneamino)anilino]phenyl]propanoate |
|---|---|
| PubChem CID | 59559085 |
| Molecular Formula | C45H44N2O6 |
| Molecular Weight | 708.86 g/mol |
| Exact Mass | 708.32 |
| IUPAC Name | oxan-2-yl 3-[4-[4-[3-(oxan-2-yloxy)-3-oxopropyl]-N-(pyren-4-ylmethylideneamino)anilino]phenyl]propanoate |
| SMILES | O=C(CCc1ccc(N(N=Cc2cc3cccc4ccc5cccc2c5c43)c2ccc(CCC(=O)OC3CCCCO3)cc2)cc1)OC1CCCCO1 |
| InChI | InChI=1S/C45H44N2O6/c48-40(52-42-11-1-3-27-50-42)25-17-31-13-21-37(22-14-31)47(38-23-15-32(16-24-38)18-26-41(49)53-43-12-2-4-28-51-43)46-30-36-29-35-9-5-7-33-19-20-34-8-6-10-39(36)45(34)44(33)35/h5-10,13-16,19-24,29-30,42-43H,1-4,11-12,17-18,25-28H2 |
| InChIKey | JQGVNPYBKKAHPW-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.86 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|