C21H28N6O2 — CID 59561393
4-[2-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]pyridin-3-yl]imino-5-(2-hydroxyethylamino)-2-methylcyclohexa-2,5-dien-1-one (PubChem CID 59561393) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 4-[2-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]pyridin-3-yl]imino-5-(2-hydroxyethylamino)-2-methylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-[2-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]pyridin-3-yl]imino-5-(2-hydroxyethylamino)-2-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 59561393 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 4-[2-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]pyridin-3-yl]imino-5-(2-hydroxyethylamino)-2-methylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=C/C(=N\c2c(NCCCN(C)C)nn3ccccc23)C(NCCO)=CC1=O |
| InChI | InChI=1S/C21H28N6O2/c1-15-13-17(16(14-19(15)29)22-9-12-28)24-20-18-7-4-5-11-27(18)25-21(20)23-8-6-10-26(2)3/h4-5,7,11,13-14,22,28H,6,8-10,12H2,1-3H3,(H,23,25)/b24-17+ |
| InChIKey | ZNIAGEWXOYUJSD-JJIBRWJFSA-N |
| XLogP | 1.77 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|