C26H43N2O10P — CID 59562200
5-[[4-[4-(butylcarbamoyloxy)butoxycarbonyloxy]-3,5-dimethylphenyl]methoxycarbonylamino]pentoxy-methylphosphinic acid (PubChem CID 59562200) has the molecular formula C26H43N2O10P and a molecular weight of 574.61 g/mol. Its IUPAC name is 5-[[4-[4-(butylcarbamoyloxy)butoxycarbonyloxy]-3,5-dimethylphenyl]methoxycarbonylamino]pentoxy-methylphosphinic acid.
| Compound Name | 5-[[4-[4-(butylcarbamoyloxy)butoxycarbonyloxy]-3,5-dimethylphenyl]methoxycarbonylamino]pentoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 59562200 |
| Molecular Formula | C26H43N2O10P |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | 5-[[4-[4-(butylcarbamoyloxy)butoxycarbonyloxy]-3,5-dimethylphenyl]methoxycarbonylamino]pentoxy-methylphosphinic acid |
| SMILES | CCCCNC(=O)OCCCCOC(=O)Oc1c(C)cc(COC(=O)NCCCCCOP(C)(=O)O)cc1C |
| InChI | InChI=1S/C26H43N2O10P/c1-5-6-12-27-24(29)34-14-10-11-15-35-26(31)38-23-20(2)17-22(18-21(23)3)19-36-25(30)28-13-8-7-9-16-37-39(4,32)33/h17-18H,5-16,19H2,1-4H3,(H,27,29)(H,28,30)(H,32,33) |
| InChIKey | UVPNODQJTANOFW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|