C17H26IN2O5PS — CID 166730479
[4-(propanoylamino)phenyl]methyl N-[6-[hydroxy(iodo)phosphinothioyl]oxyhexyl]carbamate (PubChem CID 166730479) has the molecular formula C17H26IN2O5PS and a molecular weight of 528.35 g/mol. Its IUPAC name is [4-(propanoylamino)phenyl]methyl N-[6-[hydroxy(iodo)phosphinothioyl]oxyhexyl]carbamate.
| Compound Name | [4-(propanoylamino)phenyl]methyl N-[6-[hydroxy(iodo)phosphinothioyl]oxyhexyl]carbamate |
|---|---|
| PubChem CID | 166730479 |
| Molecular Formula | C17H26IN2O5PS |
| Molecular Weight | 528.35 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | [4-(propanoylamino)phenyl]methyl N-[6-[hydroxy(iodo)phosphinothioyl]oxyhexyl]carbamate |
| SMILES | CCC(=O)Nc1ccc(COC(=O)NCCCCCCOP(O)(=S)I)cc1 |
| InChI | InChI=1S/C17H26IN2O5PS/c1-2-16(21)20-15-9-7-14(8-10-15)13-24-17(22)19-11-5-3-4-6-12-25-26(18,23)27/h7-10H,2-6,11-13H2,1H3,(H,19,22)(H,20,21)(H,23,27) |
| InChIKey | SWFHNSXMXASQOE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|