C12H15ClO5 — CID 59562745
(1'R,5'S)-3'-chloro-5'-(ethoxymethyl)spiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-6-ene]-2'-one (PubChem CID 59562745) has the molecular formula C12H15ClO5 and a molecular weight of 274.70 g/mol. Its IUPAC name is (1'R,5'S)-3'-chloro-5'-(ethoxymethyl)spiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-6-ene]-2'-one.
| Compound Name | (1'R,5'S)-3'-chloro-5'-(ethoxymethyl)spiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-6-ene]-2'-one |
|---|---|
| PubChem CID | 59562745 |
| Molecular Formula | C12H15ClO5 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (1'R,5'S)-3'-chloro-5'-(ethoxymethyl)spiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-6-ene]-2'-one |
| SMILES | CCOC[C@]12C=C[C@@H](O1)C(=O)C(Cl)C21OCCO1 |
| InChI | InChI=1S/C12H15ClO5/c1-2-15-7-11-4-3-8(18-11)9(14)10(13)12(11)16-5-6-17-12/h3-4,8,10H,2,5-7H2,1H3/t8-,10?,11+/m1/s1 |
| InChIKey | VRMAGJMZVMTNAY-WUQUSSCSSA-N |
| XLogP | 0.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|