C24H26F6N4O — CID 59570416
1-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-[3,5-bis(trifluoromethyl)anilino]-1-(6-methyl-3-pyridinyl)propan-2-one (PubChem CID 59570416) has the molecular formula C24H26F6N4O and a molecular weight of 500.49 g/mol. Its IUPAC name is 1-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-[3,5-bis(trifluoromethyl)anilino]-1-(6-methyl-3-pyridinyl)propan-2-one.
| Compound Name | 1-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-[3,5-bis(trifluoromethyl)anilino]-1-(6-methyl-3-pyridinyl)propan-2-one |
|---|---|
| PubChem CID | 59570416 |
| Molecular Formula | C24H26F6N4O |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 1-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-[3,5-bis(trifluoromethyl)anilino]-1-(6-methyl-3-pyridinyl)propan-2-one |
| SMILES | Cc1ccc(C(C(=O)CNc2cc(C(F)(F)F)cc(C(F)(F)F)c2)N2CCN3CCC[C@@H]3C2)cn1 |
| InChI | InChI=1S/C24H26F6N4O/c1-15-4-5-16(12-31-15)22(34-8-7-33-6-2-3-20(33)14-34)21(35)13-32-19-10-17(23(25,26)27)9-18(11-19)24(28,29)30/h4-5,9-12,20,22,32H,2-3,6-8,13-14H2,1H3/t20-,22?/m1/s1 |
| InChIKey | HIYUHYABWQAHRD-PSDZMVHGSA-N |
| XLogP | 4.93 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |