C15H21N5O2 — CID 59570440
tert-butyl 4-[cyano(pyrimidin-5-yl)methyl]piperazine-1-carboxylate (PubChem CID 59570440) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is tert-butyl 4-[cyano(pyrimidin-5-yl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[cyano(pyrimidin-5-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59570440 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | tert-butyl 4-[cyano(pyrimidin-5-yl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C#N)c2cncnc2)CC1 |
| InChI | InChI=1S/C15H21N5O2/c1-15(2,3)22-14(21)20-6-4-19(5-7-20)13(8-16)12-9-17-11-18-10-12/h9-11,13H,4-7H2,1-3H3 |
| InChIKey | NWCJKGCRLAHDAW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |