C12H16N4S — CID 59570480
2-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(1,3-thiazol-2-yl)acetonitrile (PubChem CID 59570480) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(1,3-thiazol-2-yl)acetonitrile.
| Compound Name | 2-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(1,3-thiazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 59570480 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(1,3-thiazol-2-yl)acetonitrile |
| SMILES | N#CC(c1nccs1)N1CCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C12H16N4S/c13-8-11(12-14-3-7-17-12)16-6-5-15-4-1-2-10(15)9-16/h3,7,10-11H,1-2,4-6,9H2/t10-,11?/m1/s1 |
| InChIKey | XTOUPOOOLYAYBN-NFJWQWPMSA-N |
| XLogP | 1.49 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |