C20H19FN2OS2 — CID 59571819
(5Z)-3-cyclohexyl-5-[[5-(4-fluorophenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 59571819) has the molecular formula C20H19FN2OS2 and a molecular weight of 386.52 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[[5-(4-fluorophenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-[[5-(4-fluorophenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 59571819 |
| Molecular Formula | C20H19FN2OS2 |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[[5-(4-fluorophenyl)thiophen-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(-c3ccc(F)cc3)s2)NC(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C20H19FN2OS2/c21-14-8-6-13(7-9-14)18-11-10-16(26-18)12-17-19(24)23(20(25)22-17)15-4-2-1-3-5-15/h6-12,15H,1-5H2,(H,22,25)/b17-12- |
| InChIKey | GXLRFCKZUBKWIR-ATVHPVEESA-N |
| XLogP | 4.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|