C24H27F3N2O6S — CID 59577883
2-[4-(2-methoxyethoxy)phenyl]-8-[2-(trifluoromethoxy)phenyl]sulfonyl-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 59577883) has the molecular formula C24H27F3N2O6S and a molecular weight of 528.55 g/mol. Its IUPAC name is 2-[4-(2-methoxyethoxy)phenyl]-8-[2-(trifluoromethoxy)phenyl]sulfonyl-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 2-[4-(2-methoxyethoxy)phenyl]-8-[2-(trifluoromethoxy)phenyl]sulfonyl-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 59577883 |
| Molecular Formula | C24H27F3N2O6S |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 2-[4-(2-methoxyethoxy)phenyl]-8-[2-(trifluoromethoxy)phenyl]sulfonyl-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | COCCOc1ccc(N2CCC3(CCN(S(=O)(=O)c4ccccc4OC(F)(F)F)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H27F3N2O6S/c1-33-16-17-34-19-8-6-18(7-9-19)29-15-12-23(22(29)30)10-13-28(14-11-23)36(31,32)21-5-3-2-4-20(21)35-24(25,26)27/h2-9H,10-17H2,1H3 |
| InChIKey | ILHRPNQMBRCZGP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|