C18H18N2O4 — CID 59578693
(E)-2-cyano-3-(3,4-dimethoxyphenyl)-N-[(5-methylfuran-2-yl)methyl]prop-2-enamide (PubChem CID 59578693) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,4-dimethoxyphenyl)-N-[(5-methylfuran-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,4-dimethoxyphenyl)-N-[(5-methylfuran-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 59578693 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (E)-2-cyano-3-(3,4-dimethoxyphenyl)-N-[(5-methylfuran-2-yl)methyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)NCc2ccc(C)o2)cc1OC |
| InChI | InChI=1S/C18H18N2O4/c1-12-4-6-15(24-12)11-20-18(21)14(10-19)8-13-5-7-16(22-2)17(9-13)23-3/h4-9H,11H2,1-3H3,(H,20,21)/b14-8+ |
| InChIKey | KFRLYZBHSOLXCW-RIYZIHGNSA-N |
| XLogP | 2.83 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|