C25H28N2O5 — CID 59579394
2-(3,5-dimethoxyphenyl)-N-[2-(oxan-4-ylmethyl)-1-oxoisoquinolin-5-yl]acetamide (PubChem CID 59579394) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-N-[2-(oxan-4-ylmethyl)-1-oxoisoquinolin-5-yl]acetamide.
| Compound Name | 2-(3,5-dimethoxyphenyl)-N-[2-(oxan-4-ylmethyl)-1-oxoisoquinolin-5-yl]acetamide |
|---|---|
| PubChem CID | 59579394 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-N-[2-(oxan-4-ylmethyl)-1-oxoisoquinolin-5-yl]acetamide |
| SMILES | COc1cc(CC(=O)Nc2cccc3c(=O)n(CC4CCOCC4)ccc23)cc(OC)c1 |
| InChI | InChI=1S/C25H28N2O5/c1-30-19-12-18(13-20(15-19)31-2)14-24(28)26-23-5-3-4-22-21(23)6-9-27(25(22)29)16-17-7-10-32-11-8-17/h3-6,9,12-13,15,17H,7-8,10-11,14,16H2,1-2H3,(H,26,28) |
| InChIKey | GLCDMXGJZRAICX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |