C26H31N3O2 — CID 59579525
N-[2-[(1-methylpiperidin-4-yl)methyl]-1-oxoisoquinolin-5-yl]-4-phenylbutanamide (PubChem CID 59579525) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[2-[(1-methylpiperidin-4-yl)methyl]-1-oxoisoquinolin-5-yl]-4-phenylbutanamide.
| Compound Name | N-[2-[(1-methylpiperidin-4-yl)methyl]-1-oxoisoquinolin-5-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 59579525 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-[2-[(1-methylpiperidin-4-yl)methyl]-1-oxoisoquinolin-5-yl]-4-phenylbutanamide |
| SMILES | CN1CCC(Cn2ccc3c(NC(=O)CCCc4ccccc4)cccc3c2=O)CC1 |
| InChI | InChI=1S/C26H31N3O2/c1-28-16-13-21(14-17-28)19-29-18-15-22-23(26(29)31)10-6-11-24(22)27-25(30)12-5-9-20-7-3-2-4-8-20/h2-4,6-8,10-11,15,18,21H,5,9,12-14,16-17,19H2,1H3,(H,27,30) |
| InChIKey | YVUZIDCAMCHCNJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |