C19H21NO6 — CID 59580236
3-phenyl-5-[(3,4,5-trimethoxyphenoxy)methyl]-1,3-oxazolidin-2-one (PubChem CID 59580236) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-phenyl-5-[(3,4,5-trimethoxyphenoxy)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-phenyl-5-[(3,4,5-trimethoxyphenoxy)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59580236 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3-phenyl-5-[(3,4,5-trimethoxyphenoxy)methyl]-1,3-oxazolidin-2-one |
| SMILES | COc1cc(OCC2CN(c3ccccc3)C(=O)O2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21NO6/c1-22-16-9-14(10-17(23-2)18(16)24-3)25-12-15-11-20(19(21)26-15)13-7-5-4-6-8-13/h4-10,15H,11-12H2,1-3H3 |
| InChIKey | DHFAFBDCOODHKR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |