C24H21Cl2FN4O3 — CID 59585483
5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-2-oxoethyl]-3-methoxybenzamide (PubChem CID 59585483) has the molecular formula C24H21Cl2FN4O3 and a molecular weight of 503.36 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-2-oxoethyl]-3-methoxybenzamide.
| Compound Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-2-oxoethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 59585483 |
| Molecular Formula | C24H21Cl2FN4O3 |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-2-oxoethyl]-3-methoxybenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N(C)C |
| InChI | InChI=1S/C24H21Cl2FN4O3/c1-31(2)23(28)13-4-6-16(19(27)8-13)20(32)11-17-18(9-15(26)10-21(17)34-3)24(33)30-22-7-5-14(25)12-29-22/h4-10,12,28H,11H2,1-3H3,(H,29,30,33)/b28-23- |
| InChIKey | YTCDFVIMHRXFQO-NFFVHWSESA-N |
| XLogP | 5.10 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|