C18H17N3O4 — CID 59587579
2-(3-methoxyanilino)-5-(4-methoxyphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 59587579) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-(3-methoxyanilino)-5-(4-methoxyphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(3-methoxyanilino)-5-(4-methoxyphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 59587579 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-(3-methoxyanilino)-5-(4-methoxyphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | COc1ccc(-c2oc(Nc3cccc(OC)c3)nc2C(N)=O)cc1 |
| InChI | InChI=1S/C18H17N3O4/c1-23-13-8-6-11(7-9-13)16-15(17(19)22)21-18(25-16)20-12-4-3-5-14(10-12)24-2/h3-10H,1-2H3,(H2,19,22)(H,20,21) |
| InChIKey | UEBHVRSBNHJPMX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |