C21H25N5O3 — CID 90813547
amino-[2-(3-methoxyanilino)-5-(4-piperazin-1-ylphenyl)-1,3-oxazol-4-yl]methanol (PubChem CID 90813547) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is amino-[2-(3-methoxyanilino)-5-(4-piperazin-1-ylphenyl)-1,3-oxazol-4-yl]methanol.
| Compound Name | amino-[2-(3-methoxyanilino)-5-(4-piperazin-1-ylphenyl)-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 90813547 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | amino-[2-(3-methoxyanilino)-5-(4-piperazin-1-ylphenyl)-1,3-oxazol-4-yl]methanol |
| SMILES | COc1cccc(Nc2nc(C(N)O)c(-c3ccc(N4CCNCC4)cc3)o2)c1 |
| InChI | InChI=1S/C21H25N5O3/c1-28-17-4-2-3-15(13-17)24-21-25-18(20(22)27)19(29-21)14-5-7-16(8-6-14)26-11-9-23-10-12-26/h2-8,13,20,23,27H,9-12,22H2,1H3,(H,24,25) |
| InChIKey | IGMYERVJNDZTEX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|