C18H25ClN4O2S2 — CID 59588791
3-chloro-N-[[2-(4-cyclopropylpiperazin-1-yl)-1,3-benzothiazol-6-yl]methyl]propane-1-sulfonamide (PubChem CID 59588791) has the molecular formula C18H25ClN4O2S2 and a molecular weight of 429.01 g/mol. Its IUPAC name is 3-chloro-N-[[2-(4-cyclopropylpiperazin-1-yl)-1,3-benzothiazol-6-yl]methyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[[2-(4-cyclopropylpiperazin-1-yl)-1,3-benzothiazol-6-yl]methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 59588791 |
| Molecular Formula | C18H25ClN4O2S2 |
| Molecular Weight | 429.01 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 3-chloro-N-[[2-(4-cyclopropylpiperazin-1-yl)-1,3-benzothiazol-6-yl]methyl]propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NCc1ccc2nc(N3CCN(C4CC4)CC3)sc2c1 |
| InChI | InChI=1S/C18H25ClN4O2S2/c19-6-1-11-27(24,25)20-13-14-2-5-16-17(12-14)26-18(21-16)23-9-7-22(8-10-23)15-3-4-15/h2,5,12,15,20H,1,3-4,6-11,13H2 |
| InChIKey | YFAHWPLMBXIJDS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.01 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|