C26H30ClN3O4 — CID 59591091
tert-butyl 2-[5-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydroisoquinolin-1-yl]acetate (PubChem CID 59591091) has the molecular formula C26H30ClN3O4 and a molecular weight of 484.00 g/mol. Its IUPAC name is tert-butyl 2-[5-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydroisoquinolin-1-yl]acetate.
| Compound Name | tert-butyl 2-[5-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydroisoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 59591091 |
| Molecular Formula | C26H30ClN3O4 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | tert-butyl 2-[5-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydroisoquinolin-1-yl]acetate |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c3CCNC4CC(=O)OC(C)(C)C)no2)cc1Cl |
| InChI | InChI=1S/C26H30ClN3O4/c1-15(2)32-22-10-9-16(13-20(22)27)25-29-24(30-34-25)19-8-6-7-18-17(19)11-12-28-21(18)14-23(31)33-26(3,4)5/h6-10,13,15,21,28H,11-12,14H2,1-5H3 |
| InChIKey | OGXQOXLINBAUII-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |