C27H27ClF3N3O6 — CID 140557356
(2,2,2-trifluoroacetyl) 4-[6-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-5-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl]butaneperoxoate (PubChem CID 140557356) has the molecular formula C27H27ClF3N3O6 and a molecular weight of 581.98 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-[6-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-5-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl]butaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-[6-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-5-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl]butaneperoxoate |
|---|---|
| PubChem CID | 140557356 |
| Molecular Formula | C27H27ClF3N3O6 |
| Molecular Weight | 581.98 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-[6-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-5-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl]butaneperoxoate |
| SMILES | Cc1c(-c2noc(-c3ccc(OC(C)C)c(Cl)c3)n2)ccc2c1CCNC2CCCC(=O)OOC(=O)C(F)(F)F |
| InChI | InChI=1S/C27H27ClF3N3O6/c1-14(2)37-22-10-7-16(13-20(22)28)25-33-24(34-38-25)18-8-9-19-17(15(18)3)11-12-32-21(19)5-4-6-23(35)39-40-26(36)27(29,30)31/h7-10,13-14,21,32H,4-6,11-12H2,1-3H3 |
| InChIKey | NLYTXYISCHXICV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.98 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|