C8H7N5O — CID 59591241
3-(4-methylimidazol-1-yl)-1,2,4-triazine-6-carbaldehyde (PubChem CID 59591241) has the molecular formula C8H7N5O and a molecular weight of 189.18 g/mol. Its IUPAC name is 3-(4-methylimidazol-1-yl)-1,2,4-triazine-6-carbaldehyde.
| Compound Name | 3-(4-methylimidazol-1-yl)-1,2,4-triazine-6-carbaldehyde |
|---|---|
| PubChem CID | 59591241 |
| Molecular Formula | C8H7N5O |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 3-(4-methylimidazol-1-yl)-1,2,4-triazine-6-carbaldehyde |
| SMILES | Cc1cn(-c2ncc(C=O)nn2)cn1 |
| InChI | InChI=1S/C8H7N5O/c1-6-3-13(5-10-6)8-9-2-7(4-14)11-12-8/h2-5H,1H3 |
| InChIKey | VPNSMDMAKFKLJT-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|