C31H36O5 — CID 59595654
[4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]cyclohexyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate (PubChem CID 59595654) has the molecular formula C31H36O5 and a molecular weight of 488.62 g/mol. Its IUPAC name is [4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]cyclohexyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate.
| Compound Name | [4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]cyclohexyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
|---|---|
| PubChem CID | 59595654 |
| Molecular Formula | C31H36O5 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | [4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]cyclohexyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
| SMILES | C=CC(=O)Oc1ccc(C#CC2CCC(OC(=O)CCc3cc(C)c(O)c(C(C)(C)C)c3)CC2)cc1 |
| InChI | InChI=1S/C31H36O5/c1-6-28(32)35-25-14-9-22(10-15-25)7-8-23-11-16-26(17-12-23)36-29(33)18-13-24-19-21(2)30(34)27(20-24)31(3,4)5/h6,9-10,14-15,19-20,23,26,34H,1,11-13,16-18H2,2-5H3 |
| InChIKey | CMUCBMAJZNMKBP-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|