C30H32O7 — CID 163429336
(4-prop-2-enoyloxyphenyl) 4-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]cyclohexa-2,4-diene-1-carboxylate (PubChem CID 163429336) has the molecular formula C30H32O7 and a molecular weight of 504.58 g/mol. Its IUPAC name is (4-prop-2-enoyloxyphenyl) 4-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]cyclohexa-2,4-diene-1-carboxylate.
| Compound Name | (4-prop-2-enoyloxyphenyl) 4-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]cyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 163429336 |
| Molecular Formula | C30H32O7 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (4-prop-2-enoyloxyphenyl) 4-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]cyclohexa-2,4-diene-1-carboxylate |
| SMILES | C=CC(=O)Oc1ccc(OC(=O)C2C=CC(OC(=O)CCc3cc(C)c(O)c(C(C)(C)C)c3)=CC2)cc1 |
| InChI | InChI=1S/C30H32O7/c1-6-26(31)35-23-12-14-24(15-13-23)37-29(34)21-8-10-22(11-9-21)36-27(32)16-7-20-17-19(2)28(33)25(18-20)30(3,4)5/h6,8,10-15,17-18,21,33H,1,7,9,16H2,2-5H3 |
| InChIKey | APCZJGOUFIAXNB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|