C24H30N4O5S — CID 59597676
N-[4-(imidazol-1-ylmethyl)phenyl]-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]acetamide (PubChem CID 59597676) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is N-[4-(imidazol-1-ylmethyl)phenyl]-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]acetamide.
| Compound Name | N-[4-(imidazol-1-ylmethyl)phenyl]-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 59597676 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-[4-(imidazol-1-ylmethyl)phenyl]-2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethoxy]acetamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCOCC(=O)Nc2ccc(Cn3ccnc3)cc2)c(C)c1 |
| InChI | InChI=1S/C24H30N4O5S/c1-18-13-22(32-4)14-19(2)24(18)34(30,31)27(3)11-12-33-16-23(29)26-21-7-5-20(6-8-21)15-28-10-9-25-17-28/h5-10,13-14,17H,11-12,15-16H2,1-4H3,(H,26,29) |
| InChIKey | LOFTYRYWSNXMRP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|