C23H29N5O4S — CID 143631851
2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]ethoxy]-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide (PubChem CID 143631851) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]ethoxy]-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide.
| Compound Name | 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]ethoxy]-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 143631851 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-[2-[(4-methoxy-2,6-dimethylphenyl)sulfinyl-methylamino]ethoxy]-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide |
| SMILES | COc1cc(C)c(S(=O)N(C)CCOCC(=O)Nc2ccc(Cn3cncn3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H29N5O4S/c1-17-11-21(31-4)12-18(2)23(17)33(30)27(3)9-10-32-14-22(29)26-20-7-5-19(6-8-20)13-28-16-24-15-25-28/h5-8,11-12,15-16H,9-10,13-14H2,1-4H3,(H,26,29) |
| InChIKey | RZKCQOQRSHIGHR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|