C23H32N8O2S — CID 59600532
2-[4-[4-[[5-[hydroxy-(2,4,6-trimethylanilino)methyl]-1,3-thiazol-2-yl]amino]-6-methyl-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol (PubChem CID 59600532) has the molecular formula C23H32N8O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-[4-[4-[[5-[hydroxy-(2,4,6-trimethylanilino)methyl]-1,3-thiazol-2-yl]amino]-6-methyl-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[4-[[5-[hydroxy-(2,4,6-trimethylanilino)methyl]-1,3-thiazol-2-yl]amino]-6-methyl-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 59600532 |
| Molecular Formula | C23H32N8O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 2-[4-[4-[[5-[hydroxy-(2,4,6-trimethylanilino)methyl]-1,3-thiazol-2-yl]amino]-6-methyl-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol |
| SMILES | Cc1cc(C)c(NC(O)c2cnc(Nc3nc(C)nc(N4CCN(CCO)CC4)n3)s2)c(C)c1 |
| InChI | InChI=1S/C23H32N8O2S/c1-14-11-15(2)19(16(3)12-14)27-20(33)18-13-24-23(34-18)29-21-25-17(4)26-22(28-21)31-7-5-30(6-8-31)9-10-32/h11-13,20,27,32-33H,5-10H2,1-4H3,(H,24,25,26,28,29) |
| InChIKey | KMOYQOPSJPZVRD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|