C23H32N8O2 — CID 91341896
2-[4-[4-methyl-6-[[5-[(2,4,6-trimethylanilino)methyl]-1,3-oxazol-2-yl]amino]-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol (PubChem CID 91341896) has the molecular formula C23H32N8O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-[4-[4-methyl-6-[[5-[(2,4,6-trimethylanilino)methyl]-1,3-oxazol-2-yl]amino]-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[4-methyl-6-[[5-[(2,4,6-trimethylanilino)methyl]-1,3-oxazol-2-yl]amino]-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 91341896 |
| Molecular Formula | C23H32N8O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 2-[4-[4-methyl-6-[[5-[(2,4,6-trimethylanilino)methyl]-1,3-oxazol-2-yl]amino]-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol |
| SMILES | Cc1cc(C)c(NCc2cnc(Nc3nc(C)nc(N4CCN(CCO)CC4)n3)o2)c(C)c1 |
| InChI | InChI=1S/C23H32N8O2/c1-15-11-16(2)20(17(3)12-15)24-13-19-14-25-23(33-19)29-21-26-18(4)27-22(28-21)31-7-5-30(6-8-31)9-10-32/h11-12,14,24,32H,5-10,13H2,1-4H3,(H,25,26,27,28,29) |
| InChIKey | HILLPTQYUGHASO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |