C25H32N3O7+ — CID 59603292
[(1S,4aR,11aR,12aS)-3-carbamoyl-10-(dimethylamino)-4,4a,6-trihydroxy-7-methoxy-2,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-1-yl]-trimethylazanium (PubChem CID 59603292) has the molecular formula C25H32N3O7+ and a molecular weight of 486.55 g/mol. Its IUPAC name is [(1S,4aR,11aR,12aS)-3-carbamoyl-10-(dimethylamino)-4,4a,6-trihydroxy-7-methoxy-2,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-1-yl]-trimethylazanium.
| Compound Name | [(1S,4aR,11aR,12aS)-3-carbamoyl-10-(dimethylamino)-4,4a,6-trihydroxy-7-methoxy-2,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-1-yl]-trimethylazanium |
|---|---|
| PubChem CID | 59603292 |
| Molecular Formula | C25H32N3O7+ |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [(1S,4aR,11aR,12aS)-3-carbamoyl-10-(dimethylamino)-4,4a,6-trihydroxy-7-methoxy-2,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-1-yl]-trimethylazanium |
| SMILES | COc1ccc(N(C)C)c2c1C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H]([N+](C)(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C25H31N3O7/c1-27(2)14-7-8-15(35-6)17-12(14)9-11-10-13-19(28(3,4)5)21(30)18(24(26)33)23(32)25(13,34)22(31)16(11)20(17)29/h7-8,11,13,19,34H,9-10H2,1-6H3,(H3-,26,29,30,31,32,33)/p+1/t11-,13-,19-,25-/m0/s1 |
| InChIKey | OVMZLXVDMUHVLW-PMEOYTFPSA-O |
| XLogP | 0.48 |
| TPSA | 150.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|