C24H28N4O3 — CID 59606946
(E)-N-hydroxy-3-[6-[(E)-3-oxo-3-[2-(4-propan-2-ylpiperazin-1-yl)phenyl]prop-1-enyl]-2-pyridinyl]prop-2-enamide (PubChem CID 59606946) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[6-[(E)-3-oxo-3-[2-(4-propan-2-ylpiperazin-1-yl)phenyl]prop-1-enyl]-2-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[6-[(E)-3-oxo-3-[2-(4-propan-2-ylpiperazin-1-yl)phenyl]prop-1-enyl]-2-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 59606946 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (E)-N-hydroxy-3-[6-[(E)-3-oxo-3-[2-(4-propan-2-ylpiperazin-1-yl)phenyl]prop-1-enyl]-2-pyridinyl]prop-2-enamide |
| SMILES | CC(C)N1CCN(c2ccccc2C(=O)/C=C/c2cccc(/C=C/C(=O)NO)n2)CC1 |
| InChI | InChI=1S/C24H28N4O3/c1-18(2)27-14-16-28(17-15-27)22-9-4-3-8-21(22)23(29)12-10-19-6-5-7-20(25-19)11-13-24(30)26-31/h3-13,18,31H,14-17H2,1-2H3,(H,26,30)/b12-10+,13-11+ |
| InChIKey | OZFBEQATJNCOLZ-DCIPZJNNSA-N |
| XLogP | 3.03 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|