C18H16N4O5S — CID 59608730
5-(4-methylphenyl)-3-[(3-sulfamoylbenzoyl)amino]-1H-pyrazole-4-carboxylic acid (PubChem CID 59608730) has the molecular formula C18H16N4O5S and a molecular weight of 400.42 g/mol. Its IUPAC name is 5-(4-methylphenyl)-3-[(3-sulfamoylbenzoyl)amino]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-(4-methylphenyl)-3-[(3-sulfamoylbenzoyl)amino]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 59608730 |
| Molecular Formula | C18H16N4O5S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 5-(4-methylphenyl)-3-[(3-sulfamoylbenzoyl)amino]-1H-pyrazole-4-carboxylic acid |
| SMILES | Cc1ccc(-c2[nH]nc(NC(=O)c3cccc(S(N)(=O)=O)c3)c2C(=O)O)cc1 |
| InChI | InChI=1S/C18H16N4O5S/c1-10-5-7-11(8-6-10)15-14(18(24)25)16(22-21-15)20-17(23)12-3-2-4-13(9-12)28(19,26)27/h2-9H,1H3,(H,24,25)(H2,19,26,27)(H2,20,21,22,23) |
| InChIKey | OHDCYJCNHOZANB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |