C21H24O6 — CID 59608843
(3-methylphenyl)methyl 2-(hydroxymethyl)-2-methyl-3-phenylmethoxycarbonyloxypropanoate (PubChem CID 59608843) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (3-methylphenyl)methyl 2-(hydroxymethyl)-2-methyl-3-phenylmethoxycarbonyloxypropanoate.
| Compound Name | (3-methylphenyl)methyl 2-(hydroxymethyl)-2-methyl-3-phenylmethoxycarbonyloxypropanoate |
|---|---|
| PubChem CID | 59608843 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (3-methylphenyl)methyl 2-(hydroxymethyl)-2-methyl-3-phenylmethoxycarbonyloxypropanoate |
| SMILES | Cc1cccc(COC(=O)C(C)(CO)COC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H24O6/c1-16-7-6-10-18(11-16)13-25-19(23)21(2,14-22)15-27-20(24)26-12-17-8-4-3-5-9-17/h3-11,22H,12-15H2,1-2H3 |
| InChIKey | MJLBOEAUEORRCW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |