C20H28O9S2 — CID 140845629
3-[[4-[[(2S)-2-(hydroxymethyl)-3-(2-methoxyethoxycarbonyloxy)-2-methylpropanoyl]oxymethyl]phenyl]methyldisulfanyl]propanoic acid (PubChem CID 140845629) has the molecular formula C20H28O9S2 and a molecular weight of 476.57 g/mol. Its IUPAC name is 3-[[4-[[(2S)-2-(hydroxymethyl)-3-(2-methoxyethoxycarbonyloxy)-2-methylpropanoyl]oxymethyl]phenyl]methyldisulfanyl]propanoic acid.
| Compound Name | 3-[[4-[[(2S)-2-(hydroxymethyl)-3-(2-methoxyethoxycarbonyloxy)-2-methylpropanoyl]oxymethyl]phenyl]methyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 140845629 |
| Molecular Formula | C20H28O9S2 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 3-[[4-[[(2S)-2-(hydroxymethyl)-3-(2-methoxyethoxycarbonyloxy)-2-methylpropanoyl]oxymethyl]phenyl]methyldisulfanyl]propanoic acid |
| SMILES | COCCOC(=O)OC[C@](C)(CO)C(=O)OCc1ccc(CSSCCC(=O)O)cc1 |
| InChI | InChI=1S/C20H28O9S2/c1-20(13-21,14-29-19(25)27-9-8-26-2)18(24)28-11-15-3-5-16(6-4-15)12-31-30-10-7-17(22)23/h3-6,21H,7-14H2,1-2H3,(H,22,23)/t20-/m0/s1 |
| InChIKey | MIJSTWHREOBAFT-FQEVSTJZSA-N |
| XLogP | 2.88 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|