C17H23FO5 — CID 122222006
(4-fluorophenyl)methyl 2-(hydroxymethyl)-2-methyl-3-pentanoyloxypropanoate (PubChem CID 122222006) has the molecular formula C17H23FO5 and a molecular weight of 326.36 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 2-(hydroxymethyl)-2-methyl-3-pentanoyloxypropanoate.
| Compound Name | (4-fluorophenyl)methyl 2-(hydroxymethyl)-2-methyl-3-pentanoyloxypropanoate |
|---|---|
| PubChem CID | 122222006 |
| Molecular Formula | C17H23FO5 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (4-fluorophenyl)methyl 2-(hydroxymethyl)-2-methyl-3-pentanoyloxypropanoate |
| SMILES | CCCCC(=O)OCC(C)(CO)C(=O)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FO5/c1-3-4-5-15(20)23-12-17(2,11-19)16(21)22-10-13-6-8-14(18)9-7-13/h6-9,19H,3-5,10-12H2,1-2H3 |
| InChIKey | LTRPGIALQYMJNR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |