C17H24O6 — CID 167311092
tert-butyl 4-[[3-hydroxy-2-(hydroxymethyl)-2-methylpropanoyl]oxymethyl]benzoate (PubChem CID 167311092) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is tert-butyl 4-[[3-hydroxy-2-(hydroxymethyl)-2-methylpropanoyl]oxymethyl]benzoate.
| Compound Name | tert-butyl 4-[[3-hydroxy-2-(hydroxymethyl)-2-methylpropanoyl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 167311092 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | tert-butyl 4-[[3-hydroxy-2-(hydroxymethyl)-2-methylpropanoyl]oxymethyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(COC(=O)C(C)(CO)CO)cc1 |
| InChI | InChI=1S/C17H24O6/c1-16(2,3)23-14(20)13-7-5-12(6-8-13)9-22-15(21)17(4,10-18)11-19/h5-8,18-19H,9-11H2,1-4H3 |
| InChIKey | XPOUKMSVMDUJFA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |