C20H28ClNO8 — CID 163775840
2-(2-methoxyethoxy)ethyl 2-[[4-(2-chloro-2-oxoethyl)phenyl]methylcarbamoyloxymethyl]-3-hydroxy-2-methylpropanoate (PubChem CID 163775840) has the molecular formula C20H28ClNO8 and a molecular weight of 445.90 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 2-[[4-(2-chloro-2-oxoethyl)phenyl]methylcarbamoyloxymethyl]-3-hydroxy-2-methylpropanoate.
| Compound Name | 2-(2-methoxyethoxy)ethyl 2-[[4-(2-chloro-2-oxoethyl)phenyl]methylcarbamoyloxymethyl]-3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 163775840 |
| Molecular Formula | C20H28ClNO8 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 2-[[4-(2-chloro-2-oxoethyl)phenyl]methylcarbamoyloxymethyl]-3-hydroxy-2-methylpropanoate |
| SMILES | COCCOCCOC(=O)C(C)(CO)COC(=O)NCc1ccc(CC(=O)Cl)cc1 |
| InChI | InChI=1S/C20H28ClNO8/c1-20(13-23,18(25)29-10-9-28-8-7-27-2)14-30-19(26)22-12-16-5-3-15(4-6-16)11-17(21)24/h3-6,23H,7-14H2,1-2H3,(H,22,26) |
| InChIKey | MKJUGSNUNCLUON-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|